C25H16N2O9 — CID 126195945
[4-[(E)-[2-(1,3-benzodioxol-5-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 4-nitrobenzoate (PubChem CID 126195945) has the molecular formula C25H16N2O9 and a molecular weight of 488.41 g/mol. Its IUPAC name is [4-[(E)-[2-(1,3-benzodioxol-5-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 4-nitrobenzoate.
| Compound Name | [4-[(E)-[2-(1,3-benzodioxol-5-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 126195945 |
| Molecular Formula | C25H16N2O9 |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | [4-[(E)-[2-(1,3-benzodioxol-5-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-2-methoxyphenyl] 4-nitrobenzoate |
| SMILES | COc1cc(/C=C2/N=C(c3ccc4c(c3)OCO4)OC2=O)ccc1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H16N2O9/c1-32-21-11-14(2-8-20(21)35-24(28)15-3-6-17(7-4-15)27(30)31)10-18-25(29)36-23(26-18)16-5-9-19-22(12-16)34-13-33-19/h2-12H,13H2,1H3/b18-10+ |
| InChIKey | NHFUTWMPMAZZAT-VCHYOVAHSA-N |
| XLogP | 3.90 |
| TPSA | 135.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|