C25H19NO5 — CID 19662083
[2-methoxy-4-[(Z)-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] benzoate (PubChem CID 19662083) has the molecular formula C25H19NO5 and a molecular weight of 413.43 g/mol. Its IUPAC name is [2-methoxy-4-[(Z)-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] benzoate.
| Compound Name | [2-methoxy-4-[(Z)-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 19662083 |
| Molecular Formula | C25H19NO5 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | [2-methoxy-4-[(Z)-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] benzoate |
| SMILES | COc1cc(/C=C2\N=C(c3ccc(C)cc3)OC2=O)ccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H19NO5/c1-16-8-11-18(12-9-16)23-26-20(25(28)31-23)14-17-10-13-21(22(15-17)29-2)30-24(27)19-6-4-3-5-7-19/h3-15H,1-2H3/b20-14- |
| InChIKey | AAJOKLSUXNVHML-ZHZULCJRSA-N |
| XLogP | 4.57 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|