C24H17NO4 — CID 1041697
[4-[[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] benzoate (PubChem CID 1041697) has the molecular formula C24H17NO4 and a molecular weight of 383.40 g/mol. Its IUPAC name is [4-[[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] benzoate.
| Compound Name | [4-[[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 1041697 |
| Molecular Formula | C24H17NO4 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | [4-[[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] benzoate |
| SMILES | Cc1ccc(C2=NC(=Cc3ccc(OC(=O)c4ccccc4)cc3)C(=O)O2)cc1 |
| InChI | InChI=1S/C24H17NO4/c1-16-7-11-18(12-8-16)22-25-21(24(27)29-22)15-17-9-13-20(14-10-17)28-23(26)19-5-3-2-4-6-19/h2-15H,1H3 |
| InChIKey | NQWBGVZXPXWNFI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|