C25H19NO4 — CID 19665311
[4-[(Z)-[5-oxo-2-(4-phenylphenyl)-1,3-oxazol-4-ylidene]methyl]phenyl] propanoate (PubChem CID 19665311) has the molecular formula C25H19NO4 and a molecular weight of 397.43 g/mol. Its IUPAC name is [4-[(Z)-[5-oxo-2-(4-phenylphenyl)-1,3-oxazol-4-ylidene]methyl]phenyl] propanoate.
| Compound Name | [4-[(Z)-[5-oxo-2-(4-phenylphenyl)-1,3-oxazol-4-ylidene]methyl]phenyl] propanoate |
|---|---|
| PubChem CID | 19665311 |
| Molecular Formula | C25H19NO4 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | [4-[(Z)-[5-oxo-2-(4-phenylphenyl)-1,3-oxazol-4-ylidene]methyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1ccc(/C=C2\N=C(c3ccc(-c4ccccc4)cc3)OC2=O)cc1 |
| InChI | InChI=1S/C25H19NO4/c1-2-23(27)29-21-14-8-17(9-15-21)16-22-25(28)30-24(26-22)20-12-10-19(11-13-20)18-6-4-3-5-7-18/h3-16H,2H2,1H3/b22-16- |
| InChIKey | FXZIBPIILJFXRM-JWGURIENSA-N |
| XLogP | 5.01 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|