C23H15NO4 — CID 2480120
4-[(E)-[5-oxo-2-(4-phenylphenyl)-1,3-oxazol-4-ylidene]methyl]benzoic acid (PubChem CID 2480120) has the molecular formula C23H15NO4 and a molecular weight of 369.38 g/mol. Its IUPAC name is 4-[(E)-[5-oxo-2-(4-phenylphenyl)-1,3-oxazol-4-ylidene]methyl]benzoic acid.
| Compound Name | 4-[(E)-[5-oxo-2-(4-phenylphenyl)-1,3-oxazol-4-ylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 2480120 |
| Molecular Formula | C23H15NO4 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 4-[(E)-[5-oxo-2-(4-phenylphenyl)-1,3-oxazol-4-ylidene]methyl]benzoic acid |
| SMILES | O=C1OC(c2ccc(-c3ccccc3)cc2)=N/C1=C/c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C23H15NO4/c25-22(26)19-8-6-15(7-9-19)14-20-23(27)28-21(24-20)18-12-10-17(11-13-18)16-4-2-1-3-5-16/h1-14H,(H,25,26)/b20-14+ |
| InChIKey | JNFNVGACTRPCEX-XSFVSMFZSA-N |
| XLogP | 4.40 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|