C18H12FNO4 — CID 2876580
methyl 4-[[2-(4-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]benzoate (PubChem CID 2876580) has the molecular formula C18H12FNO4 and a molecular weight of 325.30 g/mol. Its IUPAC name is methyl 4-[[2-(4-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]benzoate.
| Compound Name | methyl 4-[[2-(4-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 2876580 |
| Molecular Formula | C18H12FNO4 |
| Molecular Weight | 325.30 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | methyl 4-[[2-(4-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(C=C2N=C(c3ccc(F)cc3)OC2=O)cc1 |
| InChI | InChI=1S/C18H12FNO4/c1-23-17(21)13-4-2-11(3-5-13)10-15-18(22)24-16(20-15)12-6-8-14(19)9-7-12/h2-10H,1H3 |
| InChIKey | VRBPKKJIKDIQST-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|