C17H12FNO5S — CID 2184509
[4-[(Z)-[2-(4-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] methanesulfonate (PubChem CID 2184509) has the molecular formula C17H12FNO5S and a molecular weight of 361.35 g/mol. Its IUPAC name is [4-[(Z)-[2-(4-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] methanesulfonate.
| Compound Name | [4-[(Z)-[2-(4-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 2184509 |
| Molecular Formula | C17H12FNO5S |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | [4-[(Z)-[2-(4-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccc(/C=C2\N=C(c3ccc(F)cc3)OC2=O)cc1 |
| InChI | InChI=1S/C17H12FNO5S/c1-25(21,22)24-14-8-2-11(3-9-14)10-15-17(20)23-16(19-15)12-4-6-13(18)7-5-12/h2-10H,1H3/b15-10- |
| InChIKey | XZJSPTBKTGVNES-GDNBJRDFSA-N |
| XLogP | 2.51 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|