C23H16N2O7S — CID 2277072
[4-[(E)-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-nitrobenzenesulfonate (PubChem CID 2277072) has the molecular formula C23H16N2O7S and a molecular weight of 464.46 g/mol. Its IUPAC name is [4-[(E)-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-nitrobenzenesulfonate.
| Compound Name | [4-[(E)-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 2277072 |
| Molecular Formula | C23H16N2O7S |
| Molecular Weight | 464.46 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | [4-[(E)-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-nitrobenzenesulfonate |
| SMILES | Cc1ccc(C2=N/C(=C/c3ccc(OS(=O)(=O)c4ccc([N+](=O)[O-])cc4)cc3)C(=O)O2)cc1 |
| InChI | InChI=1S/C23H16N2O7S/c1-15-2-6-17(7-3-15)22-24-21(23(26)31-22)14-16-4-10-19(11-5-16)32-33(29,30)20-12-8-18(9-13-20)25(27)28/h2-14H,1H3/b21-14+ |
| InChIKey | TWZCTODJSCLLFN-KGENOOAVSA-N |
| XLogP | 4.02 |
| TPSA | 125.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|