C17H9N3O4 — CID 19665085
4-[(Z)-[2-(4-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]benzonitrile (PubChem CID 19665085) has the molecular formula C17H9N3O4 and a molecular weight of 319.28 g/mol. Its IUPAC name is 4-[(Z)-[2-(4-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]benzonitrile.
| Compound Name | 4-[(Z)-[2-(4-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]benzonitrile |
|---|---|
| PubChem CID | 19665085 |
| Molecular Formula | C17H9N3O4 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 4-[(Z)-[2-(4-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]benzonitrile |
| SMILES | N#Cc1ccc(/C=C2\N=C(c3ccc([N+](=O)[O-])cc3)OC2=O)cc1 |
| InChI | InChI=1S/C17H9N3O4/c18-10-12-3-1-11(2-4-12)9-15-17(21)24-16(19-15)13-5-7-14(8-6-13)20(22)23/h1-9H/b15-9- |
| InChIKey | WJZSNIFBVVVDJG-DHDCSXOGSA-N |
| XLogP | 2.81 |
| TPSA | 105.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|