C18H12N2O6 — CID 1098990
[4-[4-[(4-nitrophenyl)methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl] acetate (PubChem CID 1098990) has the molecular formula C18H12N2O6 and a molecular weight of 352.30 g/mol. Its IUPAC name is [4-[4-[(4-nitrophenyl)methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl] acetate.
| Compound Name | [4-[4-[(4-nitrophenyl)methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 1098990 |
| Molecular Formula | C18H12N2O6 |
| Molecular Weight | 352.30 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | [4-[4-[(4-nitrophenyl)methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C2=NC(=Cc3ccc([N+](=O)[O-])cc3)C(=O)O2)cc1 |
| InChI | InChI=1S/C18H12N2O6/c1-11(21)25-15-8-4-13(5-9-15)17-19-16(18(22)26-17)10-12-2-6-14(7-3-12)20(23)24/h2-10H,1H3 |
| InChIKey | AQZPYZCGXKHRGZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 108.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|