C24H16FNO4 — CID 19669950
[4-[(Z)-[2-(4-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 3-methylbenzoate (PubChem CID 19669950) has the molecular formula C24H16FNO4 and a molecular weight of 401.39 g/mol. Its IUPAC name is [4-[(Z)-[2-(4-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 3-methylbenzoate.
| Compound Name | [4-[(Z)-[2-(4-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 19669950 |
| Molecular Formula | C24H16FNO4 |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | [4-[(Z)-[2-(4-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)Oc2ccc(/C=C3\N=C(c4ccc(F)cc4)OC3=O)cc2)c1 |
| InChI | InChI=1S/C24H16FNO4/c1-15-3-2-4-18(13-15)23(27)29-20-11-5-16(6-12-20)14-21-24(28)30-22(26-21)17-7-9-19(25)10-8-17/h2-14H,1H3/b21-14- |
| InChIKey | NTAXAPZKSINXDS-STZFKDTASA-N |
| XLogP | 4.70 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|