C24H15ClN2O6 — CID 19662659
[4-[(Z)-[2-(4-chloro-3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 3-methylbenzoate (PubChem CID 19662659) has the molecular formula C24H15ClN2O6 and a molecular weight of 462.85 g/mol. Its IUPAC name is [4-[(Z)-[2-(4-chloro-3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 3-methylbenzoate.
| Compound Name | [4-[(Z)-[2-(4-chloro-3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 19662659 |
| Molecular Formula | C24H15ClN2O6 |
| Molecular Weight | 462.85 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | [4-[(Z)-[2-(4-chloro-3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)Oc2ccc(/C=C3\N=C(c4ccc(Cl)c([N+](=O)[O-])c4)OC3=O)cc2)c1 |
| InChI | InChI=1S/C24H15ClN2O6/c1-14-3-2-4-17(11-14)23(28)32-18-8-5-15(6-9-18)12-20-24(29)33-22(26-20)16-7-10-19(25)21(13-16)27(30)31/h2-13H,1H3/b20-12- |
| InChIKey | UCFJDRNDKCKQSK-NDENLUEZSA-N |
| XLogP | 5.12 |
| TPSA | 108.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.85 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|