C19H13NO6 — CID 1098818
methyl 4-[(Z)-[2-(1,3-benzodioxol-5-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]benzoate (PubChem CID 1098818) has the molecular formula C19H13NO6 and a molecular weight of 351.31 g/mol. Its IUPAC name is methyl 4-[(Z)-[2-(1,3-benzodioxol-5-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]benzoate.
| Compound Name | methyl 4-[(Z)-[2-(1,3-benzodioxol-5-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 1098818 |
| Molecular Formula | C19H13NO6 |
| Molecular Weight | 351.31 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | methyl 4-[(Z)-[2-(1,3-benzodioxol-5-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C2\N=C(c3ccc4c(c3)OCO4)OC2=O)cc1 |
| InChI | InChI=1S/C19H13NO6/c1-23-18(21)12-4-2-11(3-5-12)8-14-19(22)26-17(20-14)13-6-7-15-16(9-13)25-10-24-15/h2-9H,10H2,1H3/b14-8- |
| InChIKey | ISKPPQDXBINHQW-ZSOIEALJSA-N |
| XLogP | 2.55 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|