C25H15NO8 — CID 4254308
[2-[[2-(1,3-benzodioxol-5-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 4254308) has the molecular formula C25H15NO8 and a molecular weight of 457.39 g/mol. Its IUPAC name is [2-[[2-(1,3-benzodioxol-5-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [2-[[2-(1,3-benzodioxol-5-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 4254308 |
| Molecular Formula | C25H15NO8 |
| Molecular Weight | 457.39 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | [2-[[2-(1,3-benzodioxol-5-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | O=C1OC(c2ccc3c(c2)OCO3)=NC1=Cc1ccccc1OC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H15NO8/c27-24(16-6-8-20-22(11-16)32-13-30-20)33-18-4-2-1-3-14(18)9-17-25(28)34-23(26-17)15-5-7-19-21(10-15)31-12-29-19/h1-11H,12-13H2 |
| InChIKey | AKTNKTZASKDPEC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 101.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|