C25H16BrNO6 — CID 126199253
[2-[(E)-[2-(1,3-benzodioxol-5-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-4-bromophenyl] 4-methylbenzoate (PubChem CID 126199253) has the molecular formula C25H16BrNO6 and a molecular weight of 506.31 g/mol. Its IUPAC name is [2-[(E)-[2-(1,3-benzodioxol-5-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-4-bromophenyl] 4-methylbenzoate.
| Compound Name | [2-[(E)-[2-(1,3-benzodioxol-5-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-4-bromophenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 126199253 |
| Molecular Formula | C25H16BrNO6 |
| Molecular Weight | 506.31 g/mol |
| Exact Mass | 505.02 |
| IUPAC Name | [2-[(E)-[2-(1,3-benzodioxol-5-yl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-4-bromophenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(Br)cc2/C=C2/N=C(c3ccc4c(c3)OCO4)OC2=O)cc1 |
| InChI | InChI=1S/C25H16BrNO6/c1-14-2-4-15(5-3-14)24(28)32-20-9-7-18(26)10-17(20)11-19-25(29)33-23(27-19)16-6-8-21-22(12-16)31-13-30-21/h2-12H,13H2,1H3/b19-11+ |
| InChIKey | HIXYKXGYZOFPTN-YBFXNURJSA-N |
| XLogP | 5.05 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.31 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|