C24H15BrClNO5 — CID 126203020
[4-bromo-2-[(Z)-[2-(3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-chlorobenzoate (PubChem CID 126203020) has the molecular formula C24H15BrClNO5 and a molecular weight of 512.74 g/mol. Its IUPAC name is [4-bromo-2-[(Z)-[2-(3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [4-bromo-2-[(Z)-[2-(3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 126203020 |
| Molecular Formula | C24H15BrClNO5 |
| Molecular Weight | 512.74 g/mol |
| Exact Mass | 510.98 |
| IUPAC Name | [4-bromo-2-[(Z)-[2-(3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-chlorobenzoate |
| SMILES | COc1cccc(C2=N/C(=C\c3cc(Br)ccc3OC(=O)c3ccc(Cl)cc3)C(=O)O2)c1 |
| InChI | InChI=1S/C24H15BrClNO5/c1-30-19-4-2-3-15(12-19)22-27-20(24(29)32-22)13-16-11-17(25)7-10-21(16)31-23(28)14-5-8-18(26)9-6-14/h2-13H,1H3/b20-13- |
| InChIKey | YZCCEPUBQUIBAU-MOSHPQCFSA-N |
| XLogP | 5.67 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.74 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|