C17H10BrCl2NO3 — CID 6515517
(4Z)-4-[(5-bromo-2-methoxyphenyl)methylidene]-2-(3,4-dichlorophenyl)-1,3-oxazol-5-one (PubChem CID 6515517) has the molecular formula C17H10BrCl2NO3 and a molecular weight of 427.08 g/mol. Its IUPAC name is (4Z)-4-[(5-bromo-2-methoxyphenyl)methylidene]-2-(3,4-dichlorophenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(5-bromo-2-methoxyphenyl)methylidene]-2-(3,4-dichlorophenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 6515517 |
| Molecular Formula | C17H10BrCl2NO3 |
| Molecular Weight | 427.08 g/mol |
| Exact Mass | 424.92 |
| IUPAC Name | (4Z)-4-[(5-bromo-2-methoxyphenyl)methylidene]-2-(3,4-dichlorophenyl)-1,3-oxazol-5-one |
| SMILES | COc1ccc(Br)cc1/C=C1\N=C(c2ccc(Cl)c(Cl)c2)OC1=O |
| InChI | InChI=1S/C17H10BrCl2NO3/c1-23-15-5-3-11(18)6-10(15)8-14-17(22)24-16(21-14)9-2-4-12(19)13(20)7-9/h2-8H,1H3/b14-8- |
| InChIKey | MJOPNRAOCXCANL-ZSOIEALJSA-N |
| XLogP | 5.11 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.08 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|