C21H20BrNO5 — CID 2432372
(4E)-4-[(5-bromo-2-methoxyphenyl)methylidene]-2-(3,4-diethoxyphenyl)-1,3-oxazol-5-one (PubChem CID 2432372) has the molecular formula C21H20BrNO5 and a molecular weight of 446.30 g/mol. Its IUPAC name is (4E)-4-[(5-bromo-2-methoxyphenyl)methylidene]-2-(3,4-diethoxyphenyl)-1,3-oxazol-5-one.
| Compound Name | (4E)-4-[(5-bromo-2-methoxyphenyl)methylidene]-2-(3,4-diethoxyphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 2432372 |
| Molecular Formula | C21H20BrNO5 |
| Molecular Weight | 446.30 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | (4E)-4-[(5-bromo-2-methoxyphenyl)methylidene]-2-(3,4-diethoxyphenyl)-1,3-oxazol-5-one |
| SMILES | CCOc1ccc(C2=N/C(=C/c3cc(Br)ccc3OC)C(=O)O2)cc1OCC |
| InChI | InChI=1S/C21H20BrNO5/c1-4-26-18-8-6-13(12-19(18)27-5-2)20-23-16(21(24)28-20)11-14-10-15(22)7-9-17(14)25-3/h6-12H,4-5H2,1-3H3/b16-11+ |
| InChIKey | AKRIXJCJJHDJJJ-LFIBNONCSA-N |
| XLogP | 4.60 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.30 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|