C22H18BrNO7 — CID 126202712
[2-[(Z)-[2-(4-acetyloxy-3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-4-bromophenyl] propanoate (PubChem CID 126202712) has the molecular formula C22H18BrNO7 and a molecular weight of 488.29 g/mol. Its IUPAC name is [2-[(Z)-[2-(4-acetyloxy-3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-4-bromophenyl] propanoate.
| Compound Name | [2-[(Z)-[2-(4-acetyloxy-3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-4-bromophenyl] propanoate |
|---|---|
| PubChem CID | 126202712 |
| Molecular Formula | C22H18BrNO7 |
| Molecular Weight | 488.29 g/mol |
| Exact Mass | 487.03 |
| IUPAC Name | [2-[(Z)-[2-(4-acetyloxy-3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-4-bromophenyl] propanoate |
| SMILES | CCC(=O)Oc1ccc(Br)cc1/C=C1\N=C(c2ccc(OC(C)=O)c(OC)c2)OC1=O |
| InChI | InChI=1S/C22H18BrNO7/c1-4-20(26)30-17-8-6-15(23)9-14(17)10-16-22(27)31-21(24-16)13-5-7-18(29-12(2)25)19(11-13)28-3/h5-11H,4H2,1-3H3/b16-10- |
| InChIKey | ZLSCJNQKKXZIBR-YBEGLDIGSA-N |
| XLogP | 4.04 |
| TPSA | 100.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.29 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|