C27H19Br2NO7 — CID 126198011
[2-[(Z)-[2-(4-acetyloxy-3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-4,6-dibromophenyl] 3-methylbenzoate (PubChem CID 126198011) has the molecular formula C27H19Br2NO7 and a molecular weight of 629.26 g/mol. Its IUPAC name is [2-[(Z)-[2-(4-acetyloxy-3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-4,6-dibromophenyl] 3-methylbenzoate.
| Compound Name | [2-[(Z)-[2-(4-acetyloxy-3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-4,6-dibromophenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 126198011 |
| Molecular Formula | C27H19Br2NO7 |
| Molecular Weight | 629.26 g/mol |
| Exact Mass | 626.95 |
| IUPAC Name | [2-[(Z)-[2-(4-acetyloxy-3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-4,6-dibromophenyl] 3-methylbenzoate |
| SMILES | COc1cc(C2=N/C(=C\c3cc(Br)cc(Br)c3OC(=O)c3cccc(C)c3)C(=O)O2)ccc1OC(C)=O |
| InChI | InChI=1S/C27H19Br2NO7/c1-14-5-4-6-17(9-14)26(32)36-24-18(10-19(28)13-20(24)29)11-21-27(33)37-25(30-21)16-7-8-22(35-15(2)31)23(12-16)34-3/h4-13H,1-3H3/b21-11- |
| InChIKey | NFEPGABKOHQIIF-NHDPSOOVSA-N |
| XLogP | 6.02 |
| TPSA | 100.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.26 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|