C28H18Br2N2O9 — CID 126198894
[2-[(Z)-[2-(4-acetyloxy-3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-4,6-dibromophenyl] (E)-3-(4-nitrophenyl)prop-2-enoate (PubChem CID 126198894) has the molecular formula C28H18Br2N2O9 and a molecular weight of 686.27 g/mol. Its IUPAC name is [2-[(Z)-[2-(4-acetyloxy-3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-4,6-dibromophenyl] (E)-3-(4-nitrophenyl)prop-2-enoate.
| Compound Name | [2-[(Z)-[2-(4-acetyloxy-3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-4,6-dibromophenyl] (E)-3-(4-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 126198894 |
| Molecular Formula | C28H18Br2N2O9 |
| Molecular Weight | 686.27 g/mol |
| Exact Mass | 683.94 |
| IUPAC Name | [2-[(Z)-[2-(4-acetyloxy-3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-4,6-dibromophenyl] (E)-3-(4-nitrophenyl)prop-2-enoate |
| SMILES | COc1cc(C2=N/C(=C\c3cc(Br)cc(Br)c3OC(=O)/C=C/c3ccc([N+](=O)[O-])cc3)C(=O)O2)ccc1OC(C)=O |
| InChI | InChI=1S/C28H18Br2N2O9/c1-15(33)39-23-9-6-17(13-24(23)38-2)27-31-22(28(35)41-27)12-18-11-19(29)14-21(30)26(18)40-25(34)10-5-16-3-7-20(8-4-16)32(36)37/h3-14H,1-2H3/b10-5+,22-12- |
| InChIKey | DSOAGMNDQBPKSD-PETUHQMUSA-N |
| XLogP | 6.02 |
| TPSA | 143.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.27 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|