C33H24Br2N4O9 — CID 126228364
[2-[[[3-[(4-acetyloxy-3-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]-4,6-dibromophenyl] (E)-3-(4-nitrophenyl)prop-2-enoate (PubChem CID 126228364) has the molecular formula C33H24Br2N4O9 and a molecular weight of 780.38 g/mol. Its IUPAC name is [2-[[[3-[(4-acetyloxy-3-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]-4,6-dibromophenyl] (E)-3-(4-nitrophenyl)prop-2-enoate.
| Compound Name | [2-[[[3-[(4-acetyloxy-3-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]-4,6-dibromophenyl] (E)-3-(4-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 126228364 |
| Molecular Formula | C33H24Br2N4O9 |
| Molecular Weight | 780.38 g/mol |
| Exact Mass | 777.99 |
| IUPAC Name | [2-[[[3-[(4-acetyloxy-3-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]-4,6-dibromophenyl] (E)-3-(4-nitrophenyl)prop-2-enoate |
| SMILES | COc1cc(C(=O)Nc2cccc(C(=O)NN=Cc3cc(Br)cc(Br)c3OC(=O)/C=C/c3ccc([N+](=O)[O-])cc3)c2)ccc1OC(C)=O |
| InChI | InChI=1S/C33H24Br2N4O9/c1-19(40)47-28-12-9-22(16-29(28)46-2)32(42)37-25-5-3-4-21(15-25)33(43)38-36-18-23-14-24(34)17-27(35)31(23)48-30(41)13-8-20-6-10-26(11-7-20)39(44)45/h3-18H,1-2H3,(H,37,42)(H,38,43)/b13-8+,36-18? |
| InChIKey | AMDLUWJPDUEOGN-OQAQTMNFSA-N |
| XLogP | 6.69 |
| TPSA | 175.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.38 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|