C31H22Br2N4O7 — CID 126233246
[2,4-dibromo-6-[[[3-[(3-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-(4-nitrophenyl)prop-2-enoate (PubChem CID 126233246) has the molecular formula C31H22Br2N4O7 and a molecular weight of 722.35 g/mol. Its IUPAC name is [2,4-dibromo-6-[[[3-[(3-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-(4-nitrophenyl)prop-2-enoate.
| Compound Name | [2,4-dibromo-6-[[[3-[(3-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-(4-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 126233246 |
| Molecular Formula | C31H22Br2N4O7 |
| Molecular Weight | 722.35 g/mol |
| Exact Mass | 719.99 |
| IUPAC Name | [2,4-dibromo-6-[[[3-[(3-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-(4-nitrophenyl)prop-2-enoate |
| SMILES | COc1cccc(C(=O)Nc2cccc(C(=O)NN=Cc3cc(Br)cc(Br)c3OC(=O)/C=C/c3ccc([N+](=O)[O-])cc3)c2)c1 |
| InChI | InChI=1S/C31H22Br2N4O7/c1-43-26-7-3-5-21(16-26)30(39)35-24-6-2-4-20(15-24)31(40)36-34-18-22-14-23(32)17-27(33)29(22)44-28(38)13-10-19-8-11-25(12-9-19)37(41)42/h2-18H,1H3,(H,35,39)(H,36,40)/b13-10+,34-18? |
| InChIKey | XFSFXZLKQDLELS-MWHJJWBVSA-N |
| XLogP | 6.76 |
| TPSA | 149.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.35 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|