C33H28N4O8 — CID 126233478
[2-ethoxy-4-[[[3-[(4-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-(4-nitrophenyl)prop-2-enoate (PubChem CID 126233478) has the molecular formula C33H28N4O8 and a molecular weight of 608.61 g/mol. Its IUPAC name is [2-ethoxy-4-[[[3-[(4-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-(4-nitrophenyl)prop-2-enoate.
| Compound Name | [2-ethoxy-4-[[[3-[(4-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-(4-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 126233478 |
| Molecular Formula | C33H28N4O8 |
| Molecular Weight | 608.61 g/mol |
| Exact Mass | 608.19 |
| IUPAC Name | [2-ethoxy-4-[[[3-[(4-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-(4-nitrophenyl)prop-2-enoate |
| SMILES | CCOc1cc(C=NNC(=O)c2cccc(NC(=O)c3ccc(OC)cc3)c2)ccc1OC(=O)/C=C/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C33H28N4O8/c1-3-44-30-19-23(9-17-29(30)45-31(38)18-10-22-7-13-27(14-8-22)37(41)42)21-34-36-33(40)25-5-4-6-26(20-25)35-32(39)24-11-15-28(43-2)16-12-24/h4-21H,3H2,1-2H3,(H,35,39)(H,36,40)/b18-10+,34-21? |
| InChIKey | XTFNCGIZTFQVDT-MWHXDIRXSA-N |
| XLogP | 5.64 |
| TPSA | 158.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.61 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|