C33H25BrN4O9 — CID 126233896
[2-[[[3-[(4-acetyloxy-3-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]-4-bromophenyl] (E)-3-(4-nitrophenyl)prop-2-enoate (PubChem CID 126233896) has the molecular formula C33H25BrN4O9 and a molecular weight of 701.49 g/mol. Its IUPAC name is [2-[[[3-[(4-acetyloxy-3-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]-4-bromophenyl] (E)-3-(4-nitrophenyl)prop-2-enoate.
| Compound Name | [2-[[[3-[(4-acetyloxy-3-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]-4-bromophenyl] (E)-3-(4-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 126233896 |
| Molecular Formula | C33H25BrN4O9 |
| Molecular Weight | 701.49 g/mol |
| Exact Mass | 700.08 |
| IUPAC Name | [2-[[[3-[(4-acetyloxy-3-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]-4-bromophenyl] (E)-3-(4-nitrophenyl)prop-2-enoate |
| SMILES | COc1cc(C(=O)Nc2cccc(C(=O)NN=Cc3cc(Br)ccc3OC(=O)/C=C/c3ccc([N+](=O)[O-])cc3)c2)ccc1OC(C)=O |
| InChI | InChI=1S/C33H25BrN4O9/c1-20(39)46-29-13-9-23(18-30(29)45-2)32(41)36-26-5-3-4-22(17-26)33(42)37-35-19-24-16-25(34)10-14-28(24)47-31(40)15-8-21-6-11-27(12-7-21)38(43)44/h3-19H,1-2H3,(H,36,41)(H,37,42)/b15-8+,35-19? |
| InChIKey | VCEOKPIJJIJGBZ-KHGRGXQGSA-N |
| XLogP | 5.93 |
| TPSA | 175.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.49 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|