C31H24N4O9 — CID 126226492
[2-[(E)-[(4-benzamidobenzoyl)hydrazinylidene]methyl]-4-nitrophenyl] 4-acetyloxy-3-methoxybenzoate (PubChem CID 126226492) has the molecular formula C31H24N4O9 and a molecular weight of 596.55 g/mol. Its IUPAC name is [2-[(E)-[(4-benzamidobenzoyl)hydrazinylidene]methyl]-4-nitrophenyl] 4-acetyloxy-3-methoxybenzoate.
| Compound Name | [2-[(E)-[(4-benzamidobenzoyl)hydrazinylidene]methyl]-4-nitrophenyl] 4-acetyloxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 126226492 |
| Molecular Formula | C31H24N4O9 |
| Molecular Weight | 596.55 g/mol |
| Exact Mass | 596.15 |
| IUPAC Name | [2-[(E)-[(4-benzamidobenzoyl)hydrazinylidene]methyl]-4-nitrophenyl] 4-acetyloxy-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2ccc([N+](=O)[O-])cc2/C=N/NC(=O)c2ccc(NC(=O)c3ccccc3)cc2)ccc1OC(C)=O |
| InChI | InChI=1S/C31H24N4O9/c1-19(36)43-27-14-10-22(17-28(27)42-2)31(39)44-26-15-13-25(35(40)41)16-23(26)18-32-34-30(38)21-8-11-24(12-9-21)33-29(37)20-6-4-3-5-7-20/h3-18H,1-2H3,(H,33,37)(H,34,38)/b32-18+ |
| InChIKey | WJVOMVVJGBRKAN-KCSSXMTESA-N |
| XLogP | 4.76 |
| TPSA | 175.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.55 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|