C27H20N4O7 — CID 126228378
[2-[(E)-[[4-(furan-2-carbonylamino)benzoyl]hydrazinylidene]methyl]-4-nitrophenyl] 3-methylbenzoate (PubChem CID 126228378) has the molecular formula C27H20N4O7 and a molecular weight of 512.48 g/mol. Its IUPAC name is [2-[(E)-[[4-(furan-2-carbonylamino)benzoyl]hydrazinylidene]methyl]-4-nitrophenyl] 3-methylbenzoate.
| Compound Name | [2-[(E)-[[4-(furan-2-carbonylamino)benzoyl]hydrazinylidene]methyl]-4-nitrophenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 126228378 |
| Molecular Formula | C27H20N4O7 |
| Molecular Weight | 512.48 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | [2-[(E)-[[4-(furan-2-carbonylamino)benzoyl]hydrazinylidene]methyl]-4-nitrophenyl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)Oc2ccc([N+](=O)[O-])cc2/C=N/NC(=O)c2ccc(NC(=O)c3ccco3)cc2)c1 |
| InChI | InChI=1S/C27H20N4O7/c1-17-4-2-5-19(14-17)27(34)38-23-12-11-22(31(35)36)15-20(23)16-28-30-25(32)18-7-9-21(10-8-18)29-26(33)24-6-3-13-37-24/h2-16H,1H3,(H,29,33)(H,30,32)/b28-16+ |
| InChIKey | ARRRADHRACATRW-LQKURTRISA-N |
| XLogP | 4.73 |
| TPSA | 153.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|