C29H24N4O10 — CID 126226335
[2-[(E)-[[4-(furan-2-carbonylamino)benzoyl]hydrazinylidene]methyl]-6-nitrophenyl] 3,4,5-trimethoxybenzoate (PubChem CID 126226335) has the molecular formula C29H24N4O10 and a molecular weight of 588.53 g/mol. Its IUPAC name is [2-[(E)-[[4-(furan-2-carbonylamino)benzoyl]hydrazinylidene]methyl]-6-nitrophenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [2-[(E)-[[4-(furan-2-carbonylamino)benzoyl]hydrazinylidene]methyl]-6-nitrophenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 126226335 |
| Molecular Formula | C29H24N4O10 |
| Molecular Weight | 588.53 g/mol |
| Exact Mass | 588.15 |
| IUPAC Name | [2-[(E)-[[4-(furan-2-carbonylamino)benzoyl]hydrazinylidene]methyl]-6-nitrophenyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2c(/C=N/NC(=O)c3ccc(NC(=O)c4ccco4)cc3)cccc2[N+](=O)[O-])cc(OC)c1OC |
| InChI | InChI=1S/C29H24N4O10/c1-39-23-14-19(15-24(40-2)26(23)41-3)29(36)43-25-18(6-4-7-21(25)33(37)38)16-30-32-27(34)17-9-11-20(12-10-17)31-28(35)22-8-5-13-42-22/h4-16H,1-3H3,(H,31,35)(H,32,34)/b30-16+ |
| InChIKey | USHLXRNUGWHRHH-OKCVXOCRSA-N |
| XLogP | 4.45 |
| TPSA | 180.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|