C30H24N4O7 — CID 126226376
[2-[(E)-[[4-[(4-methylbenzoyl)amino]benzoyl]hydrazinylidene]methyl]-6-nitrophenyl] 4-methoxybenzoate (PubChem CID 126226376) has the molecular formula C30H24N4O7 and a molecular weight of 552.54 g/mol. Its IUPAC name is [2-[(E)-[[4-[(4-methylbenzoyl)amino]benzoyl]hydrazinylidene]methyl]-6-nitrophenyl] 4-methoxybenzoate.
| Compound Name | [2-[(E)-[[4-[(4-methylbenzoyl)amino]benzoyl]hydrazinylidene]methyl]-6-nitrophenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 126226376 |
| Molecular Formula | C30H24N4O7 |
| Molecular Weight | 552.54 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | [2-[(E)-[[4-[(4-methylbenzoyl)amino]benzoyl]hydrazinylidene]methyl]-6-nitrophenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2c(/C=N/NC(=O)c3ccc(NC(=O)c4ccc(C)cc4)cc3)cccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H24N4O7/c1-19-6-8-20(9-7-19)28(35)32-24-14-10-21(11-15-24)29(36)33-31-18-23-4-3-5-26(34(38)39)27(23)41-30(37)22-12-16-25(40-2)17-13-22/h3-18H,1-2H3,(H,32,35)(H,33,36)/b31-18+ |
| InChIKey | YZCBFJMGPXMNFQ-FDAWAROLSA-N |
| XLogP | 5.15 |
| TPSA | 149.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|