C26H24N4O9 — CID 126228502
[2-[(E)-[(4-acetamidobenzoyl)hydrazinylidene]methyl]-6-nitrophenyl] 3,4,5-trimethoxybenzoate (PubChem CID 126228502) has the molecular formula C26H24N4O9 and a molecular weight of 536.50 g/mol. Its IUPAC name is [2-[(E)-[(4-acetamidobenzoyl)hydrazinylidene]methyl]-6-nitrophenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | [2-[(E)-[(4-acetamidobenzoyl)hydrazinylidene]methyl]-6-nitrophenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 126228502 |
| Molecular Formula | C26H24N4O9 |
| Molecular Weight | 536.50 g/mol |
| Exact Mass | 536.15 |
| IUPAC Name | [2-[(E)-[(4-acetamidobenzoyl)hydrazinylidene]methyl]-6-nitrophenyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2c(/C=N/NC(=O)c3ccc(NC(C)=O)cc3)cccc2[N+](=O)[O-])cc(OC)c1OC |
| InChI | InChI=1S/C26H24N4O9/c1-15(31)28-19-10-8-16(9-11-19)25(32)29-27-14-17-6-5-7-20(30(34)35)23(17)39-26(33)18-12-21(36-2)24(38-4)22(13-18)37-3/h5-14H,1-4H3,(H,28,31)(H,29,32)/b27-14+ |
| InChIKey | CDHQMPVDKMHEPJ-MZJWZYIUSA-N |
| XLogP | 3.56 |
| TPSA | 167.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|