C22H15ClN4O8 — CID 126233112
[2-nitro-6-[(E)-[(4-nitrobenzoyl)hydrazinylidene]methyl]phenyl] 5-chloro-2-methoxybenzoate (PubChem CID 126233112) has the molecular formula C22H15ClN4O8 and a molecular weight of 498.84 g/mol. Its IUPAC name is [2-nitro-6-[(E)-[(4-nitrobenzoyl)hydrazinylidene]methyl]phenyl] 5-chloro-2-methoxybenzoate.
| Compound Name | [2-nitro-6-[(E)-[(4-nitrobenzoyl)hydrazinylidene]methyl]phenyl] 5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 126233112 |
| Molecular Formula | C22H15ClN4O8 |
| Molecular Weight | 498.84 g/mol |
| Exact Mass | 498.06 |
| IUPAC Name | [2-nitro-6-[(E)-[(4-nitrobenzoyl)hydrazinylidene]methyl]phenyl] 5-chloro-2-methoxybenzoate |
| SMILES | COc1ccc(Cl)cc1C(=O)Oc1c(/C=N/NC(=O)c2ccc([N+](=O)[O-])cc2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H15ClN4O8/c1-34-19-10-7-15(23)11-17(19)22(29)35-20-14(3-2-4-18(20)27(32)33)12-24-25-21(28)13-5-8-16(9-6-13)26(30)31/h2-12H,1H3,(H,25,28)/b24-12+ |
| InChIKey | WHLZRKGORNKQHM-WYMPLXKRSA-N |
| XLogP | 4.15 |
| TPSA | 163.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.84 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|