C21H13Cl2N3O5 — CID 126230526
[2-[(E)-[(4-chlorobenzoyl)hydrazinylidene]methyl]-6-nitrophenyl] 2-chlorobenzoate (PubChem CID 126230526) has the molecular formula C21H13Cl2N3O5 and a molecular weight of 458.26 g/mol. Its IUPAC name is [2-[(E)-[(4-chlorobenzoyl)hydrazinylidene]methyl]-6-nitrophenyl] 2-chlorobenzoate.
| Compound Name | [2-[(E)-[(4-chlorobenzoyl)hydrazinylidene]methyl]-6-nitrophenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 126230526 |
| Molecular Formula | C21H13Cl2N3O5 |
| Molecular Weight | 458.26 g/mol |
| Exact Mass | 457.02 |
| IUPAC Name | [2-[(E)-[(4-chlorobenzoyl)hydrazinylidene]methyl]-6-nitrophenyl] 2-chlorobenzoate |
| SMILES | O=C(N/N=C/c1cccc([N+](=O)[O-])c1OC(=O)c1ccccc1Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H13Cl2N3O5/c22-15-10-8-13(9-11-15)20(27)25-24-12-14-4-3-7-18(26(29)30)19(14)31-21(28)16-5-1-2-6-17(16)23/h1-12H,(H,25,27)/b24-12+ |
| InChIKey | KOCNRQHZJIXKLT-WYMPLXKRSA-N |
| XLogP | 4.88 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.26 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|