C19H11Cl2N3O6 — CID 126233991
[2-[(E)-[(2,4-dichlorobenzoyl)hydrazinylidene]methyl]-6-nitrophenyl] furan-2-carboxylate (PubChem CID 126233991) has the molecular formula C19H11Cl2N3O6 and a molecular weight of 448.22 g/mol. Its IUPAC name is [2-[(E)-[(2,4-dichlorobenzoyl)hydrazinylidene]methyl]-6-nitrophenyl] furan-2-carboxylate.
| Compound Name | [2-[(E)-[(2,4-dichlorobenzoyl)hydrazinylidene]methyl]-6-nitrophenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 126233991 |
| Molecular Formula | C19H11Cl2N3O6 |
| Molecular Weight | 448.22 g/mol |
| Exact Mass | 447.00 |
| IUPAC Name | [2-[(E)-[(2,4-dichlorobenzoyl)hydrazinylidene]methyl]-6-nitrophenyl] furan-2-carboxylate |
| SMILES | O=C(Oc1c(/C=N/NC(=O)c2ccc(Cl)cc2Cl)cccc1[N+](=O)[O-])c1ccco1 |
| InChI | InChI=1S/C19H11Cl2N3O6/c20-12-6-7-13(14(21)9-12)18(25)23-22-10-11-3-1-4-15(24(27)28)17(11)30-19(26)16-5-2-8-29-16/h1-10H,(H,23,25)/b22-10+ |
| InChIKey | WZCKETUXUSBHJX-LSHDLFTRSA-N |
| XLogP | 4.48 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.22 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|