C18H12Cl2N2O — CID 5070346
2,4-dichloro-N-(naphthalen-1-ylmethylideneamino)benzamide (PubChem CID 5070346) has the molecular formula C18H12Cl2N2O and a molecular weight of 343.21 g/mol. Its IUPAC name is 2,4-dichloro-N-(naphthalen-1-ylmethylideneamino)benzamide.
| Compound Name | 2,4-dichloro-N-(naphthalen-1-ylmethylideneamino)benzamide |
|---|---|
| PubChem CID | 5070346 |
| Molecular Formula | C18H12Cl2N2O |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 2,4-dichloro-N-(naphthalen-1-ylmethylideneamino)benzamide |
| SMILES | O=C(NN=Cc1cccc2ccccc12)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H12Cl2N2O/c19-14-8-9-16(17(20)10-14)18(23)22-21-11-13-6-3-5-12-4-1-2-7-15(12)13/h1-11H,(H,22,23) |
| InChIKey | GRAWKJSIUWDAIV-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|