C20H15Cl2N3O2 — CID 6036868
N-[2-[(2Z)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]naphthalene-1-carboxamide (PubChem CID 6036868) has the molecular formula C20H15Cl2N3O2 and a molecular weight of 400.27 g/mol. Its IUPAC name is N-[2-[(2Z)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]naphthalene-1-carboxamide.
| Compound Name | N-[2-[(2Z)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 6036868 |
| Molecular Formula | C20H15Cl2N3O2 |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | N-[2-[(2Z)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]naphthalene-1-carboxamide |
| SMILES | O=C(CNC(=O)c1cccc2ccccc12)N/N=C\c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H15Cl2N3O2/c21-15-9-8-14(18(22)10-15)11-24-25-19(26)12-23-20(27)17-7-3-5-13-4-1-2-6-16(13)17/h1-11H,12H2,(H,23,27)(H,25,26)/b24-11- |
| InChIKey | SDFQBUVWPODYHK-MYKKPKGFSA-N |
| XLogP | 4.03 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|