C14H9Cl3N2O — CID 5332948
2-chloro-N-[(E)-(2,4-dichlorophenyl)methylideneamino]benzamide (PubChem CID 5332948) has the molecular formula C14H9Cl3N2O and a molecular weight of 327.60 g/mol. Its IUPAC name is 2-chloro-N-[(E)-(2,4-dichlorophenyl)methylideneamino]benzamide.
| Compound Name | 2-chloro-N-[(E)-(2,4-dichlorophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 5332948 |
| Molecular Formula | C14H9Cl3N2O |
| Molecular Weight | 327.60 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | 2-chloro-N-[(E)-(2,4-dichlorophenyl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1ccc(Cl)cc1Cl)c1ccccc1Cl |
| InChI | InChI=1S/C14H9Cl3N2O/c15-10-6-5-9(13(17)7-10)8-18-19-14(20)11-3-1-2-4-12(11)16/h1-8H,(H,19,20)/b18-8+ |
| InChIKey | AEALUGCYHFKSGQ-QGMBQPNBSA-N |
| XLogP | 4.41 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.60 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|