C14H10Cl2N2O4 — CID 71557223
N-[(E)-(2,4-dichlorophenyl)methylideneamino]-2,3,4-trihydroxybenzamide (PubChem CID 71557223) has the molecular formula C14H10Cl2N2O4 and a molecular weight of 341.15 g/mol. Its IUPAC name is N-[(E)-(2,4-dichlorophenyl)methylideneamino]-2,3,4-trihydroxybenzamide.
| Compound Name | N-[(E)-(2,4-dichlorophenyl)methylideneamino]-2,3,4-trihydroxybenzamide |
|---|---|
| PubChem CID | 71557223 |
| Molecular Formula | C14H10Cl2N2O4 |
| Molecular Weight | 341.15 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | N-[(E)-(2,4-dichlorophenyl)methylideneamino]-2,3,4-trihydroxybenzamide |
| SMILES | O=C(N/N=C/c1ccc(Cl)cc1Cl)c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C14H10Cl2N2O4/c15-8-2-1-7(10(16)5-8)6-17-18-14(22)9-3-4-11(19)13(21)12(9)20/h1-6,19-21H,(H,18,22)/b17-6+ |
| InChIKey | DFMJWTXZIFTKIT-UBKPWBPPSA-N |
| XLogP | 2.87 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.15 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|