C26H18Cl4N6O2 — CID 139068920
N-[(E)-(2,4-dichlorophenyl)methylideneamino]pyridine-2-carboxamide (PubChem CID 139068920) has the molecular formula C26H18Cl4N6O2 and a molecular weight of 588.28 g/mol. Its IUPAC name is N-[(E)-(2,4-dichlorophenyl)methylideneamino]pyridine-2-carboxamide.
| Compound Name | N-[(E)-(2,4-dichlorophenyl)methylideneamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 139068920 |
| Molecular Formula | C26H18Cl4N6O2 |
| Molecular Weight | 588.28 g/mol |
| Exact Mass | 586.02 |
| IUPAC Name | N-[(E)-(2,4-dichlorophenyl)methylideneamino]pyridine-2-carboxamide |
| SMILES | O=C(N/N=C/c1ccc(Cl)cc1Cl)c1ccccn1.O=C(N/N=C/c1ccc(Cl)cc1Cl)c1ccccn1 |
| InChI | InChI=1S/2C13H9Cl2N3O/c2*14-10-5-4-9(11(15)7-10)8-17-18-13(19)12-3-1-2-6-16-12/h2*1-8H,(H,18,19)/b2*17-8+ |
| InChIKey | UWOAUTCSVCVZAR-QWMINLNJSA-N |
| XLogP | 6.30 |
| TPSA | 108.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.28 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|