C18H14N2O3 — CID 17126515
2,5-dihydroxy-N-[(E)-naphthalen-1-ylmethylideneamino]benzamide (PubChem CID 17126515) has the molecular formula C18H14N2O3 and a molecular weight of 306.32 g/mol. Its IUPAC name is 2,5-dihydroxy-N-[(E)-naphthalen-1-ylmethylideneamino]benzamide.
| Compound Name | 2,5-dihydroxy-N-[(E)-naphthalen-1-ylmethylideneamino]benzamide |
|---|---|
| PubChem CID | 17126515 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 2,5-dihydroxy-N-[(E)-naphthalen-1-ylmethylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1cccc2ccccc12)c1cc(O)ccc1O |
| InChI | InChI=1S/C18H14N2O3/c21-14-8-9-17(22)16(10-14)18(23)20-19-11-13-6-3-5-12-4-1-2-7-15(12)13/h1-11,21-22H,(H,20,23)/b19-11+ |
| InChIKey | YSYZPMYGOJBILY-YBFXNURJSA-N |
| XLogP | 3.01 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|