C22H18Cl2N2O2 — CID 110339606
2,4-dichloro-N-[(E)-[2-[(3-methylphenyl)methoxy]phenyl]methylideneamino]benzamide (PubChem CID 110339606) has the molecular formula C22H18Cl2N2O2 and a molecular weight of 413.30 g/mol. Its IUPAC name is 2,4-dichloro-N-[(E)-[2-[(3-methylphenyl)methoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 2,4-dichloro-N-[(E)-[2-[(3-methylphenyl)methoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 110339606 |
| Molecular Formula | C22H18Cl2N2O2 |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 2,4-dichloro-N-[(E)-[2-[(3-methylphenyl)methoxy]phenyl]methylideneamino]benzamide |
| SMILES | Cc1cccc(COc2ccccc2/C=N/NC(=O)c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C22H18Cl2N2O2/c1-15-5-4-6-16(11-15)14-28-21-8-3-2-7-17(21)13-25-26-22(27)19-10-9-18(23)12-20(19)24/h2-13H,14H2,1H3,(H,26,27)/b25-13+ |
| InChIKey | VUBIYRKEIFUCMP-DHRITJCHSA-N |
| XLogP | 5.64 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|