C21H15BrCl2N2O2 — CID 17245231
2-bromo-N-[(E)-[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]benzamide (PubChem CID 17245231) has the molecular formula C21H15BrCl2N2O2 and a molecular weight of 478.17 g/mol. Its IUPAC name is 2-bromo-N-[(E)-[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 2-bromo-N-[(E)-[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 17245231 |
| Molecular Formula | C21H15BrCl2N2O2 |
| Molecular Weight | 478.17 g/mol |
| Exact Mass | 475.97 |
| IUPAC Name | 2-bromo-N-[(E)-[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1ccccc1OCc1ccc(Cl)cc1Cl)c1ccccc1Br |
| InChI | InChI=1S/C21H15BrCl2N2O2/c22-18-7-3-2-6-17(18)21(27)26-25-12-14-5-1-4-8-20(14)28-13-15-9-10-16(23)11-19(15)24/h1-12H,13H2,(H,26,27)/b25-12+ |
| InChIKey | UGQMIMUCEWVIQS-BRJLIKDPSA-N |
| XLogP | 6.10 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.17 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|