C21H15Cl2N3O5 — CID 75210800
N-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-hydroxy-5-nitrobenzamide (PubChem CID 75210800) has the molecular formula C21H15Cl2N3O5 and a molecular weight of 460.27 g/mol. Its IUPAC name is N-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-hydroxy-5-nitrobenzamide.
| Compound Name | N-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-hydroxy-5-nitrobenzamide |
|---|---|
| PubChem CID | 75210800 |
| Molecular Formula | C21H15Cl2N3O5 |
| Molecular Weight | 460.27 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | N-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-hydroxy-5-nitrobenzamide |
| SMILES | O=C(NN=Cc1ccccc1OCc1ccc(Cl)cc1Cl)c1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C21H15Cl2N3O5/c22-15-6-5-14(18(23)9-15)12-31-20-4-2-1-3-13(20)11-24-25-21(28)17-10-16(26(29)30)7-8-19(17)27/h1-11,27H,12H2,(H,25,28) |
| InChIKey | BUMSZCCRTSOLQY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.27 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|