C20H15Cl2N3O3 — CID 96881846
N-[(E)-[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-nitroaniline (PubChem CID 96881846) has the molecular formula C20H15Cl2N3O3 and a molecular weight of 416.26 g/mol. Its IUPAC name is N-[(E)-[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-nitroaniline.
| Compound Name | N-[(E)-[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-nitroaniline |
|---|---|
| PubChem CID | 96881846 |
| Molecular Formula | C20H15Cl2N3O3 |
| Molecular Weight | 416.26 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | N-[(E)-[2-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-nitroaniline |
| SMILES | O=[N+]([O-])c1ccc(N/N=C/c2ccccc2OCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C20H15Cl2N3O3/c21-16-6-5-15(19(22)11-16)13-28-20-4-2-1-3-14(20)12-23-24-17-7-9-18(10-8-17)25(26)27/h1-12,24H,13H2/b23-12+ |
| InChIKey | UOKLJTCQXHONSX-FSJBWODESA-N |
| XLogP | 5.93 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.26 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|