C23H22ClN3O4 — CID 3357833
N-[[2-[3-(4-chloro-3-methylphenoxy)propoxy]phenyl]methylideneamino]-4-nitroaniline (PubChem CID 3357833) has the molecular formula C23H22ClN3O4 and a molecular weight of 439.90 g/mol. Its IUPAC name is N-[[2-[3-(4-chloro-3-methylphenoxy)propoxy]phenyl]methylideneamino]-4-nitroaniline.
| Compound Name | N-[[2-[3-(4-chloro-3-methylphenoxy)propoxy]phenyl]methylideneamino]-4-nitroaniline |
|---|---|
| PubChem CID | 3357833 |
| Molecular Formula | C23H22ClN3O4 |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | N-[[2-[3-(4-chloro-3-methylphenoxy)propoxy]phenyl]methylideneamino]-4-nitroaniline |
| SMILES | Cc1cc(OCCCOc2ccccc2C=NNc2ccc([N+](=O)[O-])cc2)ccc1Cl |
| InChI | InChI=1S/C23H22ClN3O4/c1-17-15-21(11-12-22(17)24)30-13-4-14-31-23-6-3-2-5-18(23)16-25-26-19-7-9-20(10-8-19)27(28)29/h2-3,5-12,15-16,26H,4,13-14H2,1H3 |
| InChIKey | RUAKEVKLRHDZSC-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|