C25H27N3O5 — CID 3972292
N-[[2-[3-(4-ethylphenoxy)propoxy]-3-methoxyphenyl]methylideneamino]-4-nitroaniline (PubChem CID 3972292) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is N-[[2-[3-(4-ethylphenoxy)propoxy]-3-methoxyphenyl]methylideneamino]-4-nitroaniline.
| Compound Name | N-[[2-[3-(4-ethylphenoxy)propoxy]-3-methoxyphenyl]methylideneamino]-4-nitroaniline |
|---|---|
| PubChem CID | 3972292 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | N-[[2-[3-(4-ethylphenoxy)propoxy]-3-methoxyphenyl]methylideneamino]-4-nitroaniline |
| SMILES | CCc1ccc(OCCCOc2c(C=NNc3ccc([N+](=O)[O-])cc3)cccc2OC)cc1 |
| InChI | InChI=1S/C25H27N3O5/c1-3-19-8-14-23(15-9-19)32-16-5-17-33-25-20(6-4-7-24(25)31-2)18-26-27-21-10-12-22(13-11-21)28(29)30/h4,6-15,18,27H,3,5,16-17H2,1-2H3 |
| InChIKey | BAIKJICJVMNHQE-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|