C27H30ClN3O5 — CID 3613123
N-[[5-chloro-2-[2-(4-hexoxyphenoxy)ethoxy]phenyl]methylideneamino]-4-nitroaniline (PubChem CID 3613123) has the molecular formula C27H30ClN3O5 and a molecular weight of 512.01 g/mol. Its IUPAC name is N-[[5-chloro-2-[2-(4-hexoxyphenoxy)ethoxy]phenyl]methylideneamino]-4-nitroaniline.
| Compound Name | N-[[5-chloro-2-[2-(4-hexoxyphenoxy)ethoxy]phenyl]methylideneamino]-4-nitroaniline |
|---|---|
| PubChem CID | 3613123 |
| Molecular Formula | C27H30ClN3O5 |
| Molecular Weight | 512.01 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | N-[[5-chloro-2-[2-(4-hexoxyphenoxy)ethoxy]phenyl]methylideneamino]-4-nitroaniline |
| SMILES | CCCCCCOc1ccc(OCCOc2ccc(Cl)cc2C=NNc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C27H30ClN3O5/c1-2-3-4-5-16-34-25-11-13-26(14-12-25)35-17-18-36-27-15-6-22(28)19-21(27)20-29-30-23-7-9-24(10-8-23)31(32)33/h6-15,19-20,30H,2-5,16-18H2,1H3 |
| InChIKey | BDWQZQHVLKDIMO-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.01 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|