C21H13ClN4O7 — CID 126232118
[2-nitro-6-[(E)-[(4-nitrobenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate (PubChem CID 126232118) has the molecular formula C21H13ClN4O7 and a molecular weight of 468.81 g/mol. Its IUPAC name is [2-nitro-6-[(E)-[(4-nitrobenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [2-nitro-6-[(E)-[(4-nitrobenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 126232118 |
| Molecular Formula | C21H13ClN4O7 |
| Molecular Weight | 468.81 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | [2-nitro-6-[(E)-[(4-nitrobenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| SMILES | O=C(N/N=C/c1cccc([N+](=O)[O-])c1OC(=O)c1ccc(Cl)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H13ClN4O7/c22-16-8-4-14(5-9-16)21(28)33-19-15(2-1-3-18(19)26(31)32)12-23-24-20(27)13-6-10-17(11-7-13)25(29)30/h1-12H,(H,24,27)/b23-12+ |
| InChIKey | SXPYLTXTDXTTGS-FSJBWODESA-N |
| XLogP | 4.14 |
| TPSA | 154.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.81 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|