C23H15N5O9 — CID 126228426
[2-nitro-6-[(E)-[(4-nitrobenzoyl)hydrazinylidene]methyl]phenyl] (E)-3-(3-nitrophenyl)prop-2-enoate (PubChem CID 126228426) has the molecular formula C23H15N5O9 and a molecular weight of 505.40 g/mol. Its IUPAC name is [2-nitro-6-[(E)-[(4-nitrobenzoyl)hydrazinylidene]methyl]phenyl] (E)-3-(3-nitrophenyl)prop-2-enoate.
| Compound Name | [2-nitro-6-[(E)-[(4-nitrobenzoyl)hydrazinylidene]methyl]phenyl] (E)-3-(3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 126228426 |
| Molecular Formula | C23H15N5O9 |
| Molecular Weight | 505.40 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | [2-nitro-6-[(E)-[(4-nitrobenzoyl)hydrazinylidene]methyl]phenyl] (E)-3-(3-nitrophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1cccc([N+](=O)[O-])c1)Oc1c(/C=N/NC(=O)c2ccc([N+](=O)[O-])cc2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H15N5O9/c29-21(12-7-15-3-1-5-19(13-15)27(33)34)37-22-17(4-2-6-20(22)28(35)36)14-24-25-23(30)16-8-10-18(11-9-16)26(31)32/h1-14H,(H,25,30)/b12-7+,24-14+ |
| InChIKey | BEAKRYCCIXHREA-XGSVMANOSA-N |
| XLogP | 3.79 |
| TPSA | 197.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|