C32H26N4O7 — CID 126226240
[2-nitro-6-[(E)-[[4-[(2-phenylacetyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 126226240) has the molecular formula C32H26N4O7 and a molecular weight of 578.58 g/mol. Its IUPAC name is [2-nitro-6-[(E)-[[4-[(2-phenylacetyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-nitro-6-[(E)-[[4-[(2-phenylacetyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 126226240 |
| Molecular Formula | C32H26N4O7 |
| Molecular Weight | 578.58 g/mol |
| Exact Mass | 578.18 |
| IUPAC Name | [2-nitro-6-[(E)-[[4-[(2-phenylacetyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)Oc2c(/C=N/NC(=O)c3ccc(NC(=O)Cc4ccccc4)cc3)cccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C32H26N4O7/c1-42-27-17-10-22(11-18-27)12-19-30(38)43-31-25(8-5-9-28(31)36(40)41)21-33-35-32(39)24-13-15-26(16-14-24)34-29(37)20-23-6-3-2-4-7-23/h2-19,21H,20H2,1H3,(H,34,37)(H,35,39)/b19-12+,33-21+ |
| InChIKey | SYVLRBAMDJXGOC-IKAUGWQKSA-N |
| XLogP | 5.17 |
| TPSA | 149.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.58 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|