C30H22N4O8 — CID 126230447
[2-nitro-6-[(E)-[[4-[(2-phenylacetyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 126230447) has the molecular formula C30H22N4O8 and a molecular weight of 566.53 g/mol. Its IUPAC name is [2-nitro-6-[(E)-[[4-[(2-phenylacetyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [2-nitro-6-[(E)-[[4-[(2-phenylacetyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 126230447 |
| Molecular Formula | C30H22N4O8 |
| Molecular Weight | 566.53 g/mol |
| Exact Mass | 566.14 |
| IUPAC Name | [2-nitro-6-[(E)-[[4-[(2-phenylacetyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | O=C(Cc1ccccc1)Nc1ccc(C(=O)N/N=C/c2cccc([N+](=O)[O-])c2OC(=O)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C30H22N4O8/c35-27(15-19-5-2-1-3-6-19)32-23-12-9-20(10-13-23)29(36)33-31-17-22-7-4-8-24(34(38)39)28(22)42-30(37)21-11-14-25-26(16-21)41-18-40-25/h1-14,16-17H,15,18H2,(H,32,35)(H,33,36)/b31-17+ |
| InChIKey | KLQIWEZGOPCNKM-KBVAKVRCSA-N |
| XLogP | 4.49 |
| TPSA | 158.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|